C31H35BrN4O3 — CID 4545097
5-[(3-bromobenzoyl)amino]-N-cyclohexyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide (PubChem CID 4545097) has the molecular formula C31H35BrN4O3 and a molecular weight of 591.55 g/mol. Its IUPAC name is 5-[(3-bromobenzoyl)amino]-N-cyclohexyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide.
| Compound Name | 5-[(3-bromobenzoyl)amino]-N-cyclohexyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 4545097 |
| Molecular Formula | C31H35BrN4O3 |
| Molecular Weight | 591.55 g/mol |
| Exact Mass | 590.19 |
| IUPAC Name | 5-[(3-bromobenzoyl)amino]-N-cyclohexyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)c3cccc(Br)c3)cc2C(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C31H35BrN4O3/c1-39-29-13-6-5-12-28(29)36-18-16-35(17-19-36)27-15-14-25(34-30(37)22-8-7-9-23(32)20-22)21-26(27)31(38)33-24-10-3-2-4-11-24/h5-9,12-15,20-21,24H,2-4,10-11,16-19H2,1H3,(H,33,38)(H,34,37) |
| InChIKey | MZRZPCIQFPKPFG-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.55 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|