C31H36N4O3 — CID 3875300
5-benzamido-N-cyclohexyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide (PubChem CID 3875300) has the molecular formula C31H36N4O3 and a molecular weight of 512.65 g/mol. Its IUPAC name is 5-benzamido-N-cyclohexyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide.
| Compound Name | 5-benzamido-N-cyclohexyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 3875300 |
| Molecular Formula | C31H36N4O3 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | 5-benzamido-N-cyclohexyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)c3ccccc3)cc2C(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C31H36N4O3/c1-38-29-15-9-8-14-28(29)35-20-18-34(19-21-35)27-17-16-25(33-30(36)23-10-4-2-5-11-23)22-26(27)31(37)32-24-12-6-3-7-13-24/h2,4-5,8-11,14-17,22,24H,3,6-7,12-13,18-21H2,1H3,(H,32,37)(H,33,36) |
| InChIKey | DHQDVODHBMMDJS-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|