C32H38N4O3 — CID 5032555
N-cyclohexyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-[(4-methylbenzoyl)amino]benzamide (PubChem CID 5032555) has the molecular formula C32H38N4O3 and a molecular weight of 526.68 g/mol. Its IUPAC name is N-cyclohexyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-[(4-methylbenzoyl)amino]benzamide.
| Compound Name | N-cyclohexyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-[(4-methylbenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 5032555 |
| Molecular Formula | C32H38N4O3 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.29 |
| IUPAC Name | N-cyclohexyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-[(4-methylbenzoyl)amino]benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)c3ccc(C)cc3)cc2C(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C32H38N4O3/c1-23-12-14-24(15-13-23)31(37)34-26-16-17-28(27(22-26)32(38)33-25-8-4-3-5-9-25)35-18-20-36(21-19-35)29-10-6-7-11-30(29)39-2/h6-7,10-17,22,25H,3-5,8-9,18-21H2,1-2H3,(H,33,38)(H,34,37) |
| InChIKey | AGRDZRCJXXQWGA-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|