C28H39N5O3 — CID 4007114
5-(cyclohexylcarbamoylamino)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-propylbenzamide (PubChem CID 4007114) has the molecular formula C28H39N5O3 and a molecular weight of 493.65 g/mol. Its IUPAC name is 5-(cyclohexylcarbamoylamino)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-propylbenzamide.
| Compound Name | 5-(cyclohexylcarbamoylamino)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-propylbenzamide |
|---|---|
| PubChem CID | 4007114 |
| Molecular Formula | C28H39N5O3 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.31 |
| IUPAC Name | 5-(cyclohexylcarbamoylamino)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-propylbenzamide |
| SMILES | CCCNC(=O)c1cc(NC(=O)NC2CCCCC2)ccc1N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C28H39N5O3/c1-3-15-29-27(34)23-20-22(31-28(35)30-21-9-5-4-6-10-21)13-14-24(23)32-16-18-33(19-17-32)25-11-7-8-12-26(25)36-2/h7-8,11-14,20-21H,3-6,9-10,15-19H2,1-2H3,(H,29,34)(H2,30,31,35) |
| InChIKey | ZNGWSQXIJUSWHW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|