C33H41N5O3 — CID 4588005
5-(cyclohexylcarbamoylamino)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(2-phenylethyl)benzamide (PubChem CID 4588005) has the molecular formula C33H41N5O3 and a molecular weight of 555.72 g/mol. Its IUPAC name is 5-(cyclohexylcarbamoylamino)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(2-phenylethyl)benzamide.
| Compound Name | 5-(cyclohexylcarbamoylamino)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 4588005 |
| Molecular Formula | C33H41N5O3 |
| Molecular Weight | 555.72 g/mol |
| Exact Mass | 555.32 |
| IUPAC Name | 5-(cyclohexylcarbamoylamino)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(2-phenylethyl)benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)NC3CCCCC3)cc2C(=O)NCCc2ccccc2)CC1 |
| InChI | InChI=1S/C33H41N5O3/c1-41-31-15-9-8-14-30(31)38-22-20-37(21-23-38)29-17-16-27(36-33(40)35-26-12-6-3-7-13-26)24-28(29)32(39)34-19-18-25-10-4-2-5-11-25/h2,4-5,8-11,14-17,24,26H,3,6-7,12-13,18-23H2,1H3,(H,34,39)(H2,35,36,40) |
| InChIKey | YLZJZMGAHIGKQP-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.72 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|