C35H39N5O3 — CID 42659968
N-cyclohexyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-(naphthalen-1-ylcarbamoylamino)benzamide (PubChem CID 42659968) has the molecular formula C35H39N5O3 and a molecular weight of 577.73 g/mol. Its IUPAC name is N-cyclohexyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-(naphthalen-1-ylcarbamoylamino)benzamide.
| Compound Name | N-cyclohexyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-(naphthalen-1-ylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 42659968 |
| Molecular Formula | C35H39N5O3 |
| Molecular Weight | 577.73 g/mol |
| Exact Mass | 577.31 |
| IUPAC Name | N-cyclohexyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-(naphthalen-1-ylcarbamoylamino)benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)Nc3cccc4ccccc34)cc2C(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C35H39N5O3/c1-43-33-17-8-7-16-32(33)40-22-20-39(21-23-40)31-19-18-27(24-29(31)34(41)36-26-12-3-2-4-13-26)37-35(42)38-30-15-9-11-25-10-5-6-14-28(25)30/h5-11,14-19,24,26H,2-4,12-13,20-23H2,1H3,(H,36,41)(H2,37,38,42) |
| InChIKey | YGBPILXDVHBTOY-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.73 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|