C36H35N5O3 — CID 42660161
N-benzyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-(naphthalen-1-ylcarbamoylamino)benzamide (PubChem CID 42660161) has the molecular formula C36H35N5O3 and a molecular weight of 585.71 g/mol. Its IUPAC name is N-benzyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-(naphthalen-1-ylcarbamoylamino)benzamide.
| Compound Name | N-benzyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-(naphthalen-1-ylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 42660161 |
| Molecular Formula | C36H35N5O3 |
| Molecular Weight | 585.71 g/mol |
| Exact Mass | 585.27 |
| IUPAC Name | N-benzyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-(naphthalen-1-ylcarbamoylamino)benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)Nc3cccc4ccccc34)cc2C(=O)NCc2ccccc2)CC1 |
| InChI | InChI=1S/C36H35N5O3/c1-44-34-17-8-7-16-33(34)41-22-20-40(21-23-41)32-19-18-28(24-30(32)35(42)37-25-26-10-3-2-4-11-26)38-36(43)39-31-15-9-13-27-12-5-6-14-29(27)31/h2-19,24H,20-23,25H2,1H3,(H,37,42)(H2,38,39,43) |
| InChIKey | GOOJNPREAHYCFQ-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.71 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|