C34H36FN5O3 — CID 3371895
5-[(3-ethylphenyl)carbamoylamino]-N-[(4-fluorophenyl)methyl]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide (PubChem CID 3371895) has the molecular formula C34H36FN5O3 and a molecular weight of 581.69 g/mol. Its IUPAC name is 5-[(3-ethylphenyl)carbamoylamino]-N-[(4-fluorophenyl)methyl]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide.
| Compound Name | 5-[(3-ethylphenyl)carbamoylamino]-N-[(4-fluorophenyl)methyl]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 3371895 |
| Molecular Formula | C34H36FN5O3 |
| Molecular Weight | 581.69 g/mol |
| Exact Mass | 581.28 |
| IUPAC Name | 5-[(3-ethylphenyl)carbamoylamino]-N-[(4-fluorophenyl)methyl]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
| SMILES | CCc1cccc(NC(=O)Nc2ccc(N3CCN(c4ccccc4OC)CC3)c(C(=O)NCc3ccc(F)cc3)c2)c1 |
| InChI | InChI=1S/C34H36FN5O3/c1-3-24-7-6-8-27(21-24)37-34(42)38-28-15-16-30(29(22-28)33(41)36-23-25-11-13-26(35)14-12-25)39-17-19-40(20-18-39)31-9-4-5-10-32(31)43-2/h4-16,21-22H,3,17-20,23H2,1-2H3,(H,36,41)(H2,37,38,42) |
| InChIKey | SIWAYLUVTNEOPB-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.69 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|