C27H28FN3O4 — CID 1063571
N-[3-[(4-fluorophenyl)methylcarbamoyl]-4-pyrrolidin-1-ylphenyl]-2,6-dimethoxybenzamide (PubChem CID 1063571) has the molecular formula C27H28FN3O4 and a molecular weight of 477.54 g/mol. Its IUPAC name is N-[3-[(4-fluorophenyl)methylcarbamoyl]-4-pyrrolidin-1-ylphenyl]-2,6-dimethoxybenzamide.
| Compound Name | N-[3-[(4-fluorophenyl)methylcarbamoyl]-4-pyrrolidin-1-ylphenyl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 1063571 |
| Molecular Formula | C27H28FN3O4 |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | N-[3-[(4-fluorophenyl)methylcarbamoyl]-4-pyrrolidin-1-ylphenyl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)Nc1ccc(N2CCCC2)c(C(=O)NCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C27H28FN3O4/c1-34-23-6-5-7-24(35-2)25(23)27(33)30-20-12-13-22(31-14-3-4-15-31)21(16-20)26(32)29-17-18-8-10-19(28)11-9-18/h5-13,16H,3-4,14-15,17H2,1-2H3,(H,29,32)(H,30,33) |
| InChIKey | OJXRWHMJNWITEL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|