C27H29FN4O4 — CID 1065631
5-[(2,4-dimethoxyphenyl)carbamoylamino]-N-[(4-fluorophenyl)methyl]-2-pyrrolidin-1-ylbenzamide (PubChem CID 1065631) has the molecular formula C27H29FN4O4 and a molecular weight of 492.55 g/mol. Its IUPAC name is 5-[(2,4-dimethoxyphenyl)carbamoylamino]-N-[(4-fluorophenyl)methyl]-2-pyrrolidin-1-ylbenzamide.
| Compound Name | 5-[(2,4-dimethoxyphenyl)carbamoylamino]-N-[(4-fluorophenyl)methyl]-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 1065631 |
| Molecular Formula | C27H29FN4O4 |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | 5-[(2,4-dimethoxyphenyl)carbamoylamino]-N-[(4-fluorophenyl)methyl]-2-pyrrolidin-1-ylbenzamide |
| SMILES | COc1ccc(NC(=O)Nc2ccc(N3CCCC3)c(C(=O)NCc3ccc(F)cc3)c2)c(OC)c1 |
| InChI | InChI=1S/C27H29FN4O4/c1-35-21-10-11-23(25(16-21)36-2)31-27(34)30-20-9-12-24(32-13-3-4-14-32)22(15-20)26(33)29-17-18-5-7-19(28)8-6-18/h5-12,15-16H,3-4,13-14,17H2,1-2H3,(H,29,33)(H2,30,31,34) |
| InChIKey | AUQLGWRIVDFRMP-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|