C25H23Cl2FN4O2 — CID 1065628
5-[(2,3-dichlorophenyl)carbamoylamino]-N-[(4-fluorophenyl)methyl]-2-pyrrolidin-1-ylbenzamide (PubChem CID 1065628) has the molecular formula C25H23Cl2FN4O2 and a molecular weight of 501.39 g/mol. Its IUPAC name is 5-[(2,3-dichlorophenyl)carbamoylamino]-N-[(4-fluorophenyl)methyl]-2-pyrrolidin-1-ylbenzamide.
| Compound Name | 5-[(2,3-dichlorophenyl)carbamoylamino]-N-[(4-fluorophenyl)methyl]-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 1065628 |
| Molecular Formula | C25H23Cl2FN4O2 |
| Molecular Weight | 501.39 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | 5-[(2,3-dichlorophenyl)carbamoylamino]-N-[(4-fluorophenyl)methyl]-2-pyrrolidin-1-ylbenzamide |
| SMILES | O=C(Nc1ccc(N2CCCC2)c(C(=O)NCc2ccc(F)cc2)c1)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C25H23Cl2FN4O2/c26-20-4-3-5-21(23(20)27)31-25(34)30-18-10-11-22(32-12-1-2-13-32)19(14-18)24(33)29-15-16-6-8-17(28)9-7-16/h3-11,14H,1-2,12-13,15H2,(H,29,33)(H2,30,31,34) |
| InChIKey | FCNSUPRYDHNOKL-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.39 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|