C26H26ClFN4O2 — CID 50783204
2-chloro-N-[3-[(4-fluorophenyl)methylcarbamoylamino]-4-piperidin-1-ylphenyl]benzamide (PubChem CID 50783204) has the molecular formula C26H26ClFN4O2 and a molecular weight of 480.97 g/mol. Its IUPAC name is 2-chloro-N-[3-[(4-fluorophenyl)methylcarbamoylamino]-4-piperidin-1-ylphenyl]benzamide.
| Compound Name | 2-chloro-N-[3-[(4-fluorophenyl)methylcarbamoylamino]-4-piperidin-1-ylphenyl]benzamide |
|---|---|
| PubChem CID | 50783204 |
| Molecular Formula | C26H26ClFN4O2 |
| Molecular Weight | 480.97 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 2-chloro-N-[3-[(4-fluorophenyl)methylcarbamoylamino]-4-piperidin-1-ylphenyl]benzamide |
| SMILES | O=C(NCc1ccc(F)cc1)Nc1cc(NC(=O)c2ccccc2Cl)ccc1N1CCCCC1 |
| InChI | InChI=1S/C26H26ClFN4O2/c27-22-7-3-2-6-21(22)25(33)30-20-12-13-24(32-14-4-1-5-15-32)23(16-20)31-26(34)29-17-18-8-10-19(28)11-9-18/h2-3,6-13,16H,1,4-5,14-15,17H2,(H,30,33)(H2,29,31,34) |
| InChIKey | VUNCSSJZHCNPRK-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.97 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|