C26H27ClN4O3 — CID 46326591
2-chloro-N-[3-[(3-methoxyphenyl)carbamoylamino]-4-piperidin-1-ylphenyl]benzamide (PubChem CID 46326591) has the molecular formula C26H27ClN4O3 and a molecular weight of 478.98 g/mol. Its IUPAC name is 2-chloro-N-[3-[(3-methoxyphenyl)carbamoylamino]-4-piperidin-1-ylphenyl]benzamide.
| Compound Name | 2-chloro-N-[3-[(3-methoxyphenyl)carbamoylamino]-4-piperidin-1-ylphenyl]benzamide |
|---|---|
| PubChem CID | 46326591 |
| Molecular Formula | C26H27ClN4O3 |
| Molecular Weight | 478.98 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 2-chloro-N-[3-[(3-methoxyphenyl)carbamoylamino]-4-piperidin-1-ylphenyl]benzamide |
| SMILES | COc1cccc(NC(=O)Nc2cc(NC(=O)c3ccccc3Cl)ccc2N2CCCCC2)c1 |
| InChI | InChI=1S/C26H27ClN4O3/c1-34-20-9-7-8-18(16-20)29-26(33)30-23-17-19(12-13-24(23)31-14-5-2-6-15-31)28-25(32)21-10-3-4-11-22(21)27/h3-4,7-13,16-17H,2,5-6,14-15H2,1H3,(H,28,32)(H2,29,30,33) |
| InChIKey | DQUVSCUGVXSDNV-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.98 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|