C27H28N4O4 — CID 46326400
methyl 2-[[5-[(4-methylbenzoyl)amino]-2-pyrrolidin-1-ylphenyl]carbamoylamino]benzoate (PubChem CID 46326400) has the molecular formula C27H28N4O4 and a molecular weight of 472.55 g/mol. Its IUPAC name is methyl 2-[[5-[(4-methylbenzoyl)amino]-2-pyrrolidin-1-ylphenyl]carbamoylamino]benzoate.
| Compound Name | methyl 2-[[5-[(4-methylbenzoyl)amino]-2-pyrrolidin-1-ylphenyl]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 46326400 |
| Molecular Formula | C27H28N4O4 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | methyl 2-[[5-[(4-methylbenzoyl)amino]-2-pyrrolidin-1-ylphenyl]carbamoylamino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)Nc1cc(NC(=O)c2ccc(C)cc2)ccc1N1CCCC1 |
| InChI | InChI=1S/C27H28N4O4/c1-18-9-11-19(12-10-18)25(32)28-20-13-14-24(31-15-5-6-16-31)23(17-20)30-27(34)29-22-8-4-3-7-21(22)26(33)35-2/h3-4,7-14,17H,5-6,15-16H2,1-2H3,(H,28,32)(H2,29,30,34) |
| InChIKey | BUFRTTLURYKBGH-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|