C25H26N4O4S — CID 46326389
methyl 3-[[5-[(3-methylbenzoyl)amino]-2-pyrrolidin-1-ylphenyl]carbamoylamino]thiophene-2-carboxylate (PubChem CID 46326389) has the molecular formula C25H26N4O4S and a molecular weight of 478.57 g/mol. Its IUPAC name is methyl 3-[[5-[(3-methylbenzoyl)amino]-2-pyrrolidin-1-ylphenyl]carbamoylamino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[5-[(3-methylbenzoyl)amino]-2-pyrrolidin-1-ylphenyl]carbamoylamino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 46326389 |
| Molecular Formula | C25H26N4O4S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | methyl 3-[[5-[(3-methylbenzoyl)amino]-2-pyrrolidin-1-ylphenyl]carbamoylamino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)Nc1cc(NC(=O)c2cccc(C)c2)ccc1N1CCCC1 |
| InChI | InChI=1S/C25H26N4O4S/c1-16-6-5-7-17(14-16)23(30)26-18-8-9-21(29-11-3-4-12-29)20(15-18)28-25(32)27-19-10-13-34-22(19)24(31)33-2/h5-10,13-15H,3-4,11-12H2,1-2H3,(H,26,30)(H2,27,28,32) |
| InChIKey | VWVLQHUXMYDBFS-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|