C26H26N4O4 — CID 46326380
N-[3-(1,3-benzodioxol-5-ylcarbamoylamino)-4-pyrrolidin-1-ylphenyl]-3-methylbenzamide (PubChem CID 46326380) has the molecular formula C26H26N4O4 and a molecular weight of 458.52 g/mol. Its IUPAC name is N-[3-(1,3-benzodioxol-5-ylcarbamoylamino)-4-pyrrolidin-1-ylphenyl]-3-methylbenzamide.
| Compound Name | N-[3-(1,3-benzodioxol-5-ylcarbamoylamino)-4-pyrrolidin-1-ylphenyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 46326380 |
| Molecular Formula | C26H26N4O4 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | N-[3-(1,3-benzodioxol-5-ylcarbamoylamino)-4-pyrrolidin-1-ylphenyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc(N3CCCC3)c(NC(=O)Nc3ccc4c(c3)OCO4)c2)c1 |
| InChI | InChI=1S/C26H26N4O4/c1-17-5-4-6-18(13-17)25(31)27-19-7-9-22(30-11-2-3-12-30)21(14-19)29-26(32)28-20-8-10-23-24(15-20)34-16-33-23/h4-10,13-15H,2-3,11-12,16H2,1H3,(H,27,31)(H2,28,29,32) |
| InChIKey | FEKFBPHEGOOKHL-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|