C26H27FN4O2 — CID 46326527
N-[3-[(3-fluorophenyl)carbamoylamino]-4-piperidin-1-ylphenyl]-3-methylbenzamide (PubChem CID 46326527) has the molecular formula C26H27FN4O2 and a molecular weight of 446.53 g/mol. Its IUPAC name is N-[3-[(3-fluorophenyl)carbamoylamino]-4-piperidin-1-ylphenyl]-3-methylbenzamide.
| Compound Name | N-[3-[(3-fluorophenyl)carbamoylamino]-4-piperidin-1-ylphenyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 46326527 |
| Molecular Formula | C26H27FN4O2 |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | N-[3-[(3-fluorophenyl)carbamoylamino]-4-piperidin-1-ylphenyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc(N3CCCCC3)c(NC(=O)Nc3cccc(F)c3)c2)c1 |
| InChI | InChI=1S/C26H27FN4O2/c1-18-7-5-8-19(15-18)25(32)28-22-11-12-24(31-13-3-2-4-14-31)23(17-22)30-26(33)29-21-10-6-9-20(27)16-21/h5-12,15-17H,2-4,13-14H2,1H3,(H,28,32)(H2,29,30,33) |
| InChIKey | FJSPYHZBSCTVEO-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|