C28H32N4O2 — CID 46326500
N-[3-[(3,5-dimethylphenyl)carbamoylamino]-4-piperidin-1-ylphenyl]-3-methylbenzamide (PubChem CID 46326500) has the molecular formula C28H32N4O2 and a molecular weight of 456.59 g/mol. Its IUPAC name is N-[3-[(3,5-dimethylphenyl)carbamoylamino]-4-piperidin-1-ylphenyl]-3-methylbenzamide.
| Compound Name | N-[3-[(3,5-dimethylphenyl)carbamoylamino]-4-piperidin-1-ylphenyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 46326500 |
| Molecular Formula | C28H32N4O2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | N-[3-[(3,5-dimethylphenyl)carbamoylamino]-4-piperidin-1-ylphenyl]-3-methylbenzamide |
| SMILES | Cc1cc(C)cc(NC(=O)Nc2cc(NC(=O)c3cccc(C)c3)ccc2N2CCCCC2)c1 |
| InChI | InChI=1S/C28H32N4O2/c1-19-8-7-9-22(15-19)27(33)29-23-10-11-26(32-12-5-4-6-13-32)25(18-23)31-28(34)30-24-16-20(2)14-21(3)17-24/h7-11,14-18H,4-6,12-13H2,1-3H3,(H,29,33)(H2,30,31,34) |
| InChIKey | QMAJKVXXRBCRTM-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|