C24H30N4O3 — CID 46326563
N-[3-(cyclopentylcarbamoylamino)-4-morpholin-4-ylphenyl]-3-methylbenzamide (PubChem CID 46326563) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is N-[3-(cyclopentylcarbamoylamino)-4-morpholin-4-ylphenyl]-3-methylbenzamide.
| Compound Name | N-[3-(cyclopentylcarbamoylamino)-4-morpholin-4-ylphenyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 46326563 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | N-[3-(cyclopentylcarbamoylamino)-4-morpholin-4-ylphenyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc(N3CCOCC3)c(NC(=O)NC3CCCC3)c2)c1 |
| InChI | InChI=1S/C24H30N4O3/c1-17-5-4-6-18(15-17)23(29)25-20-9-10-22(28-11-13-31-14-12-28)21(16-20)27-24(30)26-19-7-2-3-8-19/h4-6,9-10,15-16,19H,2-3,7-8,11-14H2,1H3,(H,25,29)(H2,26,27,30) |
| InChIKey | ZQCOCLTVCXBNJD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|