C25H25BrN4O2 — CID 46326353
N-[3-[(3-bromophenyl)carbamoylamino]-4-pyrrolidin-1-ylphenyl]-3-methylbenzamide (PubChem CID 46326353) has the molecular formula C25H25BrN4O2 and a molecular weight of 493.41 g/mol. Its IUPAC name is N-[3-[(3-bromophenyl)carbamoylamino]-4-pyrrolidin-1-ylphenyl]-3-methylbenzamide.
| Compound Name | N-[3-[(3-bromophenyl)carbamoylamino]-4-pyrrolidin-1-ylphenyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 46326353 |
| Molecular Formula | C25H25BrN4O2 |
| Molecular Weight | 493.41 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | N-[3-[(3-bromophenyl)carbamoylamino]-4-pyrrolidin-1-ylphenyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc(N3CCCC3)c(NC(=O)Nc3cccc(Br)c3)c2)c1 |
| InChI | InChI=1S/C25H25BrN4O2/c1-17-6-4-7-18(14-17)24(31)27-21-10-11-23(30-12-2-3-13-30)22(16-21)29-25(32)28-20-9-5-8-19(26)15-20/h4-11,14-16H,2-3,12-13H2,1H3,(H,27,31)(H2,28,29,32) |
| InChIKey | PSGXPIVEFBUSNR-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.41 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|