C28H32N4O3 — CID 46326508
N-[3-[(2-ethoxyphenyl)carbamoylamino]-4-piperidin-1-ylphenyl]-3-methylbenzamide (PubChem CID 46326508) has the molecular formula C28H32N4O3 and a molecular weight of 472.59 g/mol. Its IUPAC name is N-[3-[(2-ethoxyphenyl)carbamoylamino]-4-piperidin-1-ylphenyl]-3-methylbenzamide.
| Compound Name | N-[3-[(2-ethoxyphenyl)carbamoylamino]-4-piperidin-1-ylphenyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 46326508 |
| Molecular Formula | C28H32N4O3 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | N-[3-[(2-ethoxyphenyl)carbamoylamino]-4-piperidin-1-ylphenyl]-3-methylbenzamide |
| SMILES | CCOc1ccccc1NC(=O)Nc1cc(NC(=O)c2cccc(C)c2)ccc1N1CCCCC1 |
| InChI | InChI=1S/C28H32N4O3/c1-3-35-26-13-6-5-12-23(26)30-28(34)31-24-19-22(14-15-25(24)32-16-7-4-8-17-32)29-27(33)21-11-9-10-20(2)18-21/h5-6,9-15,18-19H,3-4,7-8,16-17H2,1-2H3,(H,29,33)(H2,30,31,34) |
| InChIKey | MWOYWSLNESYWHK-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|