C23H28N4O3 — CID 1065611
N-cyclopropyl-5-[(2-ethoxyphenyl)carbamoylamino]-2-pyrrolidin-1-ylbenzamide (PubChem CID 1065611) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is N-cyclopropyl-5-[(2-ethoxyphenyl)carbamoylamino]-2-pyrrolidin-1-ylbenzamide.
| Compound Name | N-cyclopropyl-5-[(2-ethoxyphenyl)carbamoylamino]-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 1065611 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | N-cyclopropyl-5-[(2-ethoxyphenyl)carbamoylamino]-2-pyrrolidin-1-ylbenzamide |
| SMILES | CCOc1ccccc1NC(=O)Nc1ccc(N2CCCC2)c(C(=O)NC2CC2)c1 |
| InChI | InChI=1S/C23H28N4O3/c1-2-30-21-8-4-3-7-19(21)26-23(29)25-17-11-12-20(27-13-5-6-14-27)18(15-17)22(28)24-16-9-10-16/h3-4,7-8,11-12,15-16H,2,5-6,9-10,13-14H2,1H3,(H,24,28)(H2,25,26,29) |
| InChIKey | JEZOGNALQWMUBB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|