C26H37N5O3 — CID 4566951
N-[2-(diethylamino)ethyl]-5-[(2-ethoxyphenyl)carbamoylamino]-2-pyrrolidin-1-ylbenzamide (PubChem CID 4566951) has the molecular formula C26H37N5O3 and a molecular weight of 467.61 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-5-[(2-ethoxyphenyl)carbamoylamino]-2-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-5-[(2-ethoxyphenyl)carbamoylamino]-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 4566951 |
| Molecular Formula | C26H37N5O3 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-5-[(2-ethoxyphenyl)carbamoylamino]-2-pyrrolidin-1-ylbenzamide |
| SMILES | CCOc1ccccc1NC(=O)Nc1ccc(N2CCCC2)c(C(=O)NCCN(CC)CC)c1 |
| InChI | InChI=1S/C26H37N5O3/c1-4-30(5-2)18-15-27-25(32)21-19-20(13-14-23(21)31-16-9-10-17-31)28-26(33)29-22-11-7-8-12-24(22)34-6-3/h7-8,11-14,19H,4-6,9-10,15-18H2,1-3H3,(H,27,32)(H2,28,29,33) |
| InChIKey | DMNSUUIADXBWNY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|