C32H42N6O3 — CID 42661965
N-[2-(diethylamino)ethyl]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-[(3-methylphenyl)carbamoylamino]benzamide (PubChem CID 42661965) has the molecular formula C32H42N6O3 and a molecular weight of 558.73 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-[(3-methylphenyl)carbamoylamino]benzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-[(3-methylphenyl)carbamoylamino]benzamide |
|---|---|
| PubChem CID | 42661965 |
| Molecular Formula | C32H42N6O3 |
| Molecular Weight | 558.73 g/mol |
| Exact Mass | 558.33 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-[(3-methylphenyl)carbamoylamino]benzamide |
| SMILES | CCN(CC)CCNC(=O)c1cc(NC(=O)Nc2cccc(C)c2)ccc1N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C32H42N6O3/c1-5-36(6-2)17-16-33-31(39)27-23-26(35-32(40)34-25-11-9-10-24(3)22-25)14-15-28(27)37-18-20-38(21-19-37)29-12-7-8-13-30(29)41-4/h7-15,22-23H,5-6,16-21H2,1-4H3,(H,33,39)(H2,34,35,40) |
| InChIKey | OFPRBFOIGPNRJI-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.73 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|