C31H39N5O3 — CID 42661861
5-[(2,6-dimethylphenyl)carbamoylamino]-N,N-diethyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide (PubChem CID 42661861) has the molecular formula C31H39N5O3 and a molecular weight of 529.69 g/mol. Its IUPAC name is 5-[(2,6-dimethylphenyl)carbamoylamino]-N,N-diethyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide.
| Compound Name | 5-[(2,6-dimethylphenyl)carbamoylamino]-N,N-diethyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 42661861 |
| Molecular Formula | C31H39N5O3 |
| Molecular Weight | 529.69 g/mol |
| Exact Mass | 529.31 |
| IUPAC Name | 5-[(2,6-dimethylphenyl)carbamoylamino]-N,N-diethyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
| SMILES | CCN(CC)C(=O)c1cc(NC(=O)Nc2c(C)cccc2C)ccc1N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C31H39N5O3/c1-6-34(7-2)30(37)25-21-24(32-31(38)33-29-22(3)11-10-12-23(29)4)15-16-26(25)35-17-19-36(20-18-35)27-13-8-9-14-28(27)39-5/h8-16,21H,6-7,17-20H2,1-5H3,(H2,32,33,38) |
| InChIKey | UYBKDDMKZFNKMX-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.69 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|