C23H30N4O2 — CID 1067210
N,N-diethyl-5-[(2-methylphenyl)carbamoylamino]-2-pyrrolidin-1-ylbenzamide (PubChem CID 1067210) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is N,N-diethyl-5-[(2-methylphenyl)carbamoylamino]-2-pyrrolidin-1-ylbenzamide.
| Compound Name | N,N-diethyl-5-[(2-methylphenyl)carbamoylamino]-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 1067210 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | N,N-diethyl-5-[(2-methylphenyl)carbamoylamino]-2-pyrrolidin-1-ylbenzamide |
| SMILES | CCN(CC)C(=O)c1cc(NC(=O)Nc2ccccc2C)ccc1N1CCCC1 |
| InChI | InChI=1S/C23H30N4O2/c1-4-26(5-2)22(28)19-16-18(12-13-21(19)27-14-8-9-15-27)24-23(29)25-20-11-7-6-10-17(20)3/h6-7,10-13,16H,4-5,8-9,14-15H2,1-3H3,(H2,24,25,29) |
| InChIKey | VMBGXGKIZFCLDS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|