C23H29ClN4O2 — CID 1066980
5-[(4-chlorophenyl)carbamoylamino]-N,N-diethyl-2-piperidin-1-ylbenzamide (PubChem CID 1066980) has the molecular formula C23H29ClN4O2 and a molecular weight of 428.96 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)carbamoylamino]-N,N-diethyl-2-piperidin-1-ylbenzamide.
| Compound Name | 5-[(4-chlorophenyl)carbamoylamino]-N,N-diethyl-2-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 1066980 |
| Molecular Formula | C23H29ClN4O2 |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 5-[(4-chlorophenyl)carbamoylamino]-N,N-diethyl-2-piperidin-1-ylbenzamide |
| SMILES | CCN(CC)C(=O)c1cc(NC(=O)Nc2ccc(Cl)cc2)ccc1N1CCCCC1 |
| InChI | InChI=1S/C23H29ClN4O2/c1-3-27(4-2)22(29)20-16-19(12-13-21(20)28-14-6-5-7-15-28)26-23(30)25-18-10-8-17(24)9-11-18/h8-13,16H,3-7,14-15H2,1-2H3,(H2,25,26,30) |
| InChIKey | UXYGSVCBIIPACI-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|