C22H27ClN4O2 — CID 1065276
N-[(2R)-butan-2-yl]-5-[(4-chlorophenyl)carbamoylamino]-2-pyrrolidin-1-ylbenzamide (PubChem CID 1065276) has the molecular formula C22H27ClN4O2 and a molecular weight of 414.94 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-5-[(4-chlorophenyl)carbamoylamino]-2-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[(2R)-butan-2-yl]-5-[(4-chlorophenyl)carbamoylamino]-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 1065276 |
| Molecular Formula | C22H27ClN4O2 |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | N-[(2R)-butan-2-yl]-5-[(4-chlorophenyl)carbamoylamino]-2-pyrrolidin-1-ylbenzamide |
| SMILES | CC[C@@H](C)NC(=O)c1cc(NC(=O)Nc2ccc(Cl)cc2)ccc1N1CCCC1 |
| InChI | InChI=1S/C22H27ClN4O2/c1-3-15(2)24-21(28)19-14-18(10-11-20(19)27-12-4-5-13-27)26-22(29)25-17-8-6-16(23)7-9-17/h6-11,14-15H,3-5,12-13H2,1-2H3,(H,24,28)(H2,25,26,29)/t15-/m1/s1 |
| InChIKey | JBWFFPWVLJDLHB-OAHLLOKOSA-N |
| XLogP | 5.11 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|