C24H32N4O2 — CID 1065146
N-[(2R)-butan-2-yl]-5-[(2-methylphenyl)carbamoylamino]-2-piperidin-1-ylbenzamide (PubChem CID 1065146) has the molecular formula C24H32N4O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-5-[(2-methylphenyl)carbamoylamino]-2-piperidin-1-ylbenzamide.
| Compound Name | N-[(2R)-butan-2-yl]-5-[(2-methylphenyl)carbamoylamino]-2-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 1065146 |
| Molecular Formula | C24H32N4O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | N-[(2R)-butan-2-yl]-5-[(2-methylphenyl)carbamoylamino]-2-piperidin-1-ylbenzamide |
| SMILES | CC[C@@H](C)NC(=O)c1cc(NC(=O)Nc2ccccc2C)ccc1N1CCCCC1 |
| InChI | InChI=1S/C24H32N4O2/c1-4-18(3)25-23(29)20-16-19(12-13-22(20)28-14-8-5-9-15-28)26-24(30)27-21-11-7-6-10-17(21)2/h6-7,10-13,16,18H,4-5,8-9,14-15H2,1-3H3,(H,25,29)(H2,26,27,30)/t18-/m1/s1 |
| InChIKey | NJERNDPVSXTHGV-GOSISDBHSA-N |
| XLogP | 5.16 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|