C30H37N5O4 — CID 4042669
N-butan-2-yl-5-[(2-methoxyphenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide (PubChem CID 4042669) has the molecular formula C30H37N5O4 and a molecular weight of 531.66 g/mol. Its IUPAC name is N-butan-2-yl-5-[(2-methoxyphenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide.
| Compound Name | N-butan-2-yl-5-[(2-methoxyphenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 4042669 |
| Molecular Formula | C30H37N5O4 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.28 |
| IUPAC Name | N-butan-2-yl-5-[(2-methoxyphenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
| SMILES | CCC(C)NC(=O)c1cc(NC(=O)Nc2ccccc2OC)ccc1N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C30H37N5O4/c1-5-21(2)31-29(36)23-20-22(32-30(37)33-24-10-6-8-12-27(24)38-3)14-15-25(23)34-16-18-35(19-17-34)26-11-7-9-13-28(26)39-4/h6-15,20-21H,5,16-19H2,1-4H3,(H,31,36)(H2,32,33,37) |
| InChIKey | AVAHMSFOGWZPFA-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|