C33H36N4O3 — CID 5111456
N-[3-(butan-2-ylcarbamoyl)-4-[4-(2-methoxyphenyl)piperazin-1-yl]phenyl]naphthalene-1-carboxamide (PubChem CID 5111456) has the molecular formula C33H36N4O3 and a molecular weight of 536.68 g/mol. Its IUPAC name is N-[3-(butan-2-ylcarbamoyl)-4-[4-(2-methoxyphenyl)piperazin-1-yl]phenyl]naphthalene-1-carboxamide.
| Compound Name | N-[3-(butan-2-ylcarbamoyl)-4-[4-(2-methoxyphenyl)piperazin-1-yl]phenyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 5111456 |
| Molecular Formula | C33H36N4O3 |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.28 |
| IUPAC Name | N-[3-(butan-2-ylcarbamoyl)-4-[4-(2-methoxyphenyl)piperazin-1-yl]phenyl]naphthalene-1-carboxamide |
| SMILES | CCC(C)NC(=O)c1cc(NC(=O)c2cccc3ccccc23)ccc1N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C33H36N4O3/c1-4-23(2)34-33(39)28-22-25(35-32(38)27-13-9-11-24-10-5-6-12-26(24)27)16-17-29(28)36-18-20-37(21-19-36)30-14-7-8-15-31(30)40-3/h5-17,22-23H,4,18-21H2,1-3H3,(H,34,39)(H,35,38) |
| InChIKey | OIDFQLPPLGBBBK-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|