C26H36N4O3 — CID 42752791
2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-(3-methylbutanoylamino)-N-propan-2-ylbenzamide (PubChem CID 42752791) has the molecular formula C26H36N4O3 and a molecular weight of 452.60 g/mol. Its IUPAC name is 2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-(3-methylbutanoylamino)-N-propan-2-ylbenzamide.
| Compound Name | 2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-(3-methylbutanoylamino)-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 42752791 |
| Molecular Formula | C26H36N4O3 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | 2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-(3-methylbutanoylamino)-N-propan-2-ylbenzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)CC(C)C)cc2C(=O)NC(C)C)CC1 |
| InChI | InChI=1S/C26H36N4O3/c1-18(2)16-25(31)28-20-10-11-22(21(17-20)26(32)27-19(3)4)29-12-14-30(15-13-29)23-8-6-7-9-24(23)33-5/h6-11,17-19H,12-16H2,1-5H3,(H,27,32)(H,28,31) |
| InChIKey | UCLGJRJFIQZLEX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|