C29H33FN4O3 — CID 42752794
5-[[2-(4-fluorophenyl)acetyl]amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-propan-2-ylbenzamide (PubChem CID 42752794) has the molecular formula C29H33FN4O3 and a molecular weight of 504.61 g/mol. Its IUPAC name is 5-[[2-(4-fluorophenyl)acetyl]amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-propan-2-ylbenzamide.
| Compound Name | 5-[[2-(4-fluorophenyl)acetyl]amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 42752794 |
| Molecular Formula | C29H33FN4O3 |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | 5-[[2-(4-fluorophenyl)acetyl]amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-propan-2-ylbenzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)Cc3ccc(F)cc3)cc2C(=O)NC(C)C)CC1 |
| InChI | InChI=1S/C29H33FN4O3/c1-20(2)31-29(36)24-19-23(32-28(35)18-21-8-10-22(30)11-9-21)12-13-25(24)33-14-16-34(17-15-33)26-6-4-5-7-27(26)37-3/h4-13,19-20H,14-18H2,1-3H3,(H,31,36)(H,32,35) |
| InChIKey | FHWBSFFXOXAUQF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|