C23H28FN3O2 — CID 42751065
5-[[2-(4-fluorophenyl)acetyl]amino]-N-(2-methylpropyl)-2-pyrrolidin-1-ylbenzamide (PubChem CID 42751065) has the molecular formula C23H28FN3O2 and a molecular weight of 397.49 g/mol. Its IUPAC name is 5-[[2-(4-fluorophenyl)acetyl]amino]-N-(2-methylpropyl)-2-pyrrolidin-1-ylbenzamide.
| Compound Name | 5-[[2-(4-fluorophenyl)acetyl]amino]-N-(2-methylpropyl)-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 42751065 |
| Molecular Formula | C23H28FN3O2 |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 5-[[2-(4-fluorophenyl)acetyl]amino]-N-(2-methylpropyl)-2-pyrrolidin-1-ylbenzamide |
| SMILES | CC(C)CNC(=O)c1cc(NC(=O)Cc2ccc(F)cc2)ccc1N1CCCC1 |
| InChI | InChI=1S/C23H28FN3O2/c1-16(2)15-25-23(29)20-14-19(9-10-21(20)27-11-3-4-12-27)26-22(28)13-17-5-7-18(24)8-6-17/h5-10,14,16H,3-4,11-13,15H2,1-2H3,(H,25,29)(H,26,28) |
| InChIKey | SOIDQZFTOSBZMD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|