C28H37FN4O3 — CID 42678175
N-[(4-fluorophenyl)methyl]-2-[4-(3-methylbutanoyl)-1,4-diazepan-1-yl]-5-(2-methylpropanoylamino)benzamide (PubChem CID 42678175) has the molecular formula C28H37FN4O3 and a molecular weight of 496.63 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-[4-(3-methylbutanoyl)-1,4-diazepan-1-yl]-5-(2-methylpropanoylamino)benzamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-[4-(3-methylbutanoyl)-1,4-diazepan-1-yl]-5-(2-methylpropanoylamino)benzamide |
|---|---|
| PubChem CID | 42678175 |
| Molecular Formula | C28H37FN4O3 |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-[4-(3-methylbutanoyl)-1,4-diazepan-1-yl]-5-(2-methylpropanoylamino)benzamide |
| SMILES | CC(C)CC(=O)N1CCCN(c2ccc(NC(=O)C(C)C)cc2C(=O)NCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C28H37FN4O3/c1-19(2)16-26(34)33-13-5-12-32(14-15-33)25-11-10-23(31-27(35)20(3)4)17-24(25)28(36)30-18-21-6-8-22(29)9-7-21/h6-11,17,19-20H,5,12-16,18H2,1-4H3,(H,30,36)(H,31,35) |
| InChIKey | MOHHYOKDFMGRDP-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|