C26H33FN4O3 — CID 42678071
N-[(4-fluorophenyl)methyl]-2-[4-(3-methylbutanoyl)piperazin-1-yl]-5-(propanoylamino)benzamide (PubChem CID 42678071) has the molecular formula C26H33FN4O3 and a molecular weight of 468.57 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-[4-(3-methylbutanoyl)piperazin-1-yl]-5-(propanoylamino)benzamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-[4-(3-methylbutanoyl)piperazin-1-yl]-5-(propanoylamino)benzamide |
|---|---|
| PubChem CID | 42678071 |
| Molecular Formula | C26H33FN4O3 |
| Molecular Weight | 468.57 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-[4-(3-methylbutanoyl)piperazin-1-yl]-5-(propanoylamino)benzamide |
| SMILES | CCC(=O)Nc1ccc(N2CCN(C(=O)CC(C)C)CC2)c(C(=O)NCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C26H33FN4O3/c1-4-24(32)29-21-9-10-23(30-11-13-31(14-12-30)25(33)15-18(2)3)22(16-21)26(34)28-17-19-5-7-20(27)8-6-19/h5-10,16,18H,4,11-15,17H2,1-3H3,(H,28,34)(H,29,32) |
| InChIKey | CUUMUXHISVULLL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.57 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|