C31H36FN3O2 — CID 42762451
2-(4-benzylpiperidin-1-yl)-N-[(4-fluorophenyl)methyl]-5-(3-methylbutanoylamino)benzamide (PubChem CID 42762451) has the molecular formula C31H36FN3O2 and a molecular weight of 501.65 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-N-[(4-fluorophenyl)methyl]-5-(3-methylbutanoylamino)benzamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-N-[(4-fluorophenyl)methyl]-5-(3-methylbutanoylamino)benzamide |
|---|---|
| PubChem CID | 42762451 |
| Molecular Formula | C31H36FN3O2 |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.28 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-N-[(4-fluorophenyl)methyl]-5-(3-methylbutanoylamino)benzamide |
| SMILES | CC(C)CC(=O)Nc1ccc(N2CCC(Cc3ccccc3)CC2)c(C(=O)NCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C31H36FN3O2/c1-22(2)18-30(36)34-27-12-13-29(28(20-27)31(37)33-21-25-8-10-26(32)11-9-25)35-16-14-24(15-17-35)19-23-6-4-3-5-7-23/h3-13,20,22,24H,14-19,21H2,1-2H3,(H,33,37)(H,34,36) |
| InChIKey | KWTUFWNKZGPHRW-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|