C29H34FN3O3S — CID 1064347
2-(4-benzylpiperidin-1-yl)-5-[(4-fluorophenyl)sulfonylamino]-N-(2-methylpropyl)benzamide (PubChem CID 1064347) has the molecular formula C29H34FN3O3S and a molecular weight of 523.67 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-5-[(4-fluorophenyl)sulfonylamino]-N-(2-methylpropyl)benzamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-5-[(4-fluorophenyl)sulfonylamino]-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 1064347 |
| Molecular Formula | C29H34FN3O3S |
| Molecular Weight | 523.67 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-5-[(4-fluorophenyl)sulfonylamino]-N-(2-methylpropyl)benzamide |
| SMILES | CC(C)CNC(=O)c1cc(NS(=O)(=O)c2ccc(F)cc2)ccc1N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C29H34FN3O3S/c1-21(2)20-31-29(34)27-19-25(32-37(35,36)26-11-8-24(30)9-12-26)10-13-28(27)33-16-14-23(15-17-33)18-22-6-4-3-5-7-22/h3-13,19,21,23,32H,14-18,20H2,1-2H3,(H,31,34) |
| InChIKey | VPQVPDCRCMNHDA-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.67 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|