C29H32FN3O2 — CID 5032503
2-(4-benzylpiperidin-1-yl)-5-[(3-fluorobenzoyl)amino]-N-propan-2-ylbenzamide (PubChem CID 5032503) has the molecular formula C29H32FN3O2 and a molecular weight of 473.59 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-5-[(3-fluorobenzoyl)amino]-N-propan-2-ylbenzamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-5-[(3-fluorobenzoyl)amino]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 5032503 |
| Molecular Formula | C29H32FN3O2 |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-5-[(3-fluorobenzoyl)amino]-N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)c1cc(NC(=O)c2cccc(F)c2)ccc1N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C29H32FN3O2/c1-20(2)31-29(35)26-19-25(32-28(34)23-9-6-10-24(30)18-23)11-12-27(26)33-15-13-22(14-16-33)17-21-7-4-3-5-8-21/h3-12,18-20,22H,13-17H2,1-2H3,(H,31,35)(H,32,34) |
| InChIKey | RWPORQUJNNEFRQ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|