C24H24FN3O — CID 113015460
N-[6-(4-benzylpiperidin-1-yl)-3-pyridinyl]-3-fluorobenzamide (PubChem CID 113015460) has the molecular formula C24H24FN3O and a molecular weight of 389.47 g/mol. Its IUPAC name is N-[6-(4-benzylpiperidin-1-yl)-3-pyridinyl]-3-fluorobenzamide.
| Compound Name | N-[6-(4-benzylpiperidin-1-yl)-3-pyridinyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 113015460 |
| Molecular Formula | C24H24FN3O |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | N-[6-(4-benzylpiperidin-1-yl)-3-pyridinyl]-3-fluorobenzamide |
| SMILES | O=C(Nc1ccc(N2CCC(Cc3ccccc3)CC2)nc1)c1cccc(F)c1 |
| InChI | InChI=1S/C24H24FN3O/c25-21-8-4-7-20(16-21)24(29)27-22-9-10-23(26-17-22)28-13-11-19(12-14-28)15-18-5-2-1-3-6-18/h1-10,16-17,19H,11-15H2,(H,27,29) |
| InChIKey | MRAPJWLIMHFZJC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |