C24H20F4N4O2 — CID 46041909
N-[6-[4-(3-fluorobenzoyl)piperazin-1-yl]-3-pyridinyl]-4-(trifluoromethyl)benzamide (PubChem CID 46041909) has the molecular formula C24H20F4N4O2 and a molecular weight of 472.44 g/mol. Its IUPAC name is N-[6-[4-(3-fluorobenzoyl)piperazin-1-yl]-3-pyridinyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[6-[4-(3-fluorobenzoyl)piperazin-1-yl]-3-pyridinyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 46041909 |
| Molecular Formula | C24H20F4N4O2 |
| Molecular Weight | 472.44 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | N-[6-[4-(3-fluorobenzoyl)piperazin-1-yl]-3-pyridinyl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)c3cccc(F)c3)CC2)nc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H20F4N4O2/c25-19-3-1-2-17(14-19)23(34)32-12-10-31(11-13-32)21-9-8-20(15-29-21)30-22(33)16-4-6-18(7-5-16)24(26,27)28/h1-9,14-15H,10-13H2,(H,30,33) |
| InChIKey | OZRROQYTYKJLAE-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |