C24H22F2N4O3 — CID 46053044
N-[6-[4-(3,5-difluorobenzoyl)piperazin-1-yl]-3-pyridinyl]-3-methoxybenzamide (PubChem CID 46053044) has the molecular formula C24H22F2N4O3 and a molecular weight of 452.46 g/mol. Its IUPAC name is N-[6-[4-(3,5-difluorobenzoyl)piperazin-1-yl]-3-pyridinyl]-3-methoxybenzamide.
| Compound Name | N-[6-[4-(3,5-difluorobenzoyl)piperazin-1-yl]-3-pyridinyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 46053044 |
| Molecular Formula | C24H22F2N4O3 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | N-[6-[4-(3,5-difluorobenzoyl)piperazin-1-yl]-3-pyridinyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc(N3CCN(C(=O)c4cc(F)cc(F)c4)CC3)nc2)c1 |
| InChI | InChI=1S/C24H22F2N4O3/c1-33-21-4-2-3-16(13-21)23(31)28-20-5-6-22(27-15-20)29-7-9-30(10-8-29)24(32)17-11-18(25)14-19(26)12-17/h2-6,11-15H,7-10H2,1H3,(H,28,31) |
| InChIKey | JXOXFGILBOACAZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |