C25H26N4O3 — CID 46053043
3-methoxy-N-[6-[4-(2-phenylacetyl)piperazin-1-yl]-3-pyridinyl]benzamide (PubChem CID 46053043) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is 3-methoxy-N-[6-[4-(2-phenylacetyl)piperazin-1-yl]-3-pyridinyl]benzamide.
| Compound Name | 3-methoxy-N-[6-[4-(2-phenylacetyl)piperazin-1-yl]-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 46053043 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 3-methoxy-N-[6-[4-(2-phenylacetyl)piperazin-1-yl]-3-pyridinyl]benzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc(N3CCN(C(=O)Cc4ccccc4)CC3)nc2)c1 |
| InChI | InChI=1S/C25H26N4O3/c1-32-22-9-5-8-20(17-22)25(31)27-21-10-11-23(26-18-21)28-12-14-29(15-13-28)24(30)16-19-6-3-2-4-7-19/h2-11,17-18H,12-16H2,1H3,(H,27,31) |
| InChIKey | FWCOWEOKNPZTTK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |