C19H21F2N5O2 — CID 46161079
1-[6-[4-(3,5-difluorobenzoyl)piperazin-1-yl]-3-pyridinyl]-3-ethylurea (PubChem CID 46161079) has the molecular formula C19H21F2N5O2 and a molecular weight of 389.41 g/mol. Its IUPAC name is 1-[6-[4-(3,5-difluorobenzoyl)piperazin-1-yl]-3-pyridinyl]-3-ethylurea.
| Compound Name | 1-[6-[4-(3,5-difluorobenzoyl)piperazin-1-yl]-3-pyridinyl]-3-ethylurea |
|---|---|
| PubChem CID | 46161079 |
| Molecular Formula | C19H21F2N5O2 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 1-[6-[4-(3,5-difluorobenzoyl)piperazin-1-yl]-3-pyridinyl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1ccc(N2CCN(C(=O)c3cc(F)cc(F)c3)CC2)nc1 |
| InChI | InChI=1S/C19H21F2N5O2/c1-2-22-19(28)24-16-3-4-17(23-12-16)25-5-7-26(8-6-25)18(27)13-9-14(20)11-15(21)10-13/h3-4,9-12H,2,5-8H2,1H3,(H2,22,24,28) |
| InChIKey | WSPJIQORYCYKTC-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |