C25H26FN5O2 — CID 46053438
1-[6-[4-(4-fluorobenzoyl)-1,4-diazepan-1-yl]-3-pyridinyl]-3-(3-methylphenyl)urea (PubChem CID 46053438) has the molecular formula C25H26FN5O2 and a molecular weight of 447.51 g/mol. Its IUPAC name is 1-[6-[4-(4-fluorobenzoyl)-1,4-diazepan-1-yl]-3-pyridinyl]-3-(3-methylphenyl)urea.
| Compound Name | 1-[6-[4-(4-fluorobenzoyl)-1,4-diazepan-1-yl]-3-pyridinyl]-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 46053438 |
| Molecular Formula | C25H26FN5O2 |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 1-[6-[4-(4-fluorobenzoyl)-1,4-diazepan-1-yl]-3-pyridinyl]-3-(3-methylphenyl)urea |
| SMILES | Cc1cccc(NC(=O)Nc2ccc(N3CCCN(C(=O)c4ccc(F)cc4)CC3)nc2)c1 |
| InChI | InChI=1S/C25H26FN5O2/c1-18-4-2-5-21(16-18)28-25(33)29-22-10-11-23(27-17-22)30-12-3-13-31(15-14-30)24(32)19-6-8-20(26)9-7-19/h2,4-11,16-17H,3,12-15H2,1H3,(H2,28,29,33) |
| InChIKey | DTWNJDCMWZCDPD-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |