C24H23FN4O2 — CID 46053170
N-[6-(4-benzoyl-1,4-diazepan-1-yl)-3-pyridinyl]-2-fluorobenzamide (PubChem CID 46053170) has the molecular formula C24H23FN4O2 and a molecular weight of 418.47 g/mol. Its IUPAC name is N-[6-(4-benzoyl-1,4-diazepan-1-yl)-3-pyridinyl]-2-fluorobenzamide.
| Compound Name | N-[6-(4-benzoyl-1,4-diazepan-1-yl)-3-pyridinyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 46053170 |
| Molecular Formula | C24H23FN4O2 |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | N-[6-(4-benzoyl-1,4-diazepan-1-yl)-3-pyridinyl]-2-fluorobenzamide |
| SMILES | O=C(Nc1ccc(N2CCCN(C(=O)c3ccccc3)CC2)nc1)c1ccccc1F |
| InChI | InChI=1S/C24H23FN4O2/c25-21-10-5-4-9-20(21)23(30)27-19-11-12-22(26-17-19)28-13-6-14-29(16-15-28)24(31)18-7-2-1-3-8-18/h1-5,7-12,17H,6,13-16H2,(H,27,30) |
| InChIKey | IFMMKJBRNCSYOV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |