C24H25FN4O — CID 46053831
N-[6-(4-benzyl-1,4-diazepan-1-yl)-3-pyridinyl]-2-fluorobenzamide (PubChem CID 46053831) has the molecular formula C24H25FN4O and a molecular weight of 404.49 g/mol. Its IUPAC name is N-[6-(4-benzyl-1,4-diazepan-1-yl)-3-pyridinyl]-2-fluorobenzamide.
| Compound Name | N-[6-(4-benzyl-1,4-diazepan-1-yl)-3-pyridinyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 46053831 |
| Molecular Formula | C24H25FN4O |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | N-[6-(4-benzyl-1,4-diazepan-1-yl)-3-pyridinyl]-2-fluorobenzamide |
| SMILES | O=C(Nc1ccc(N2CCCN(Cc3ccccc3)CC2)nc1)c1ccccc1F |
| InChI | InChI=1S/C24H25FN4O/c25-22-10-5-4-9-21(22)24(30)27-20-11-12-23(26-17-20)29-14-6-13-28(15-16-29)18-19-7-2-1-3-8-19/h1-5,7-12,17H,6,13-16,18H2,(H,27,30) |
| InChIKey | WHKBUTRWXWGGIF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |