C25H28N4O2 — CID 46054009
N-[6-(4-benzyl-1,4-diazepan-1-yl)-3-pyridinyl]-2-phenoxyacetamide (PubChem CID 46054009) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is N-[6-(4-benzyl-1,4-diazepan-1-yl)-3-pyridinyl]-2-phenoxyacetamide.
| Compound Name | N-[6-(4-benzyl-1,4-diazepan-1-yl)-3-pyridinyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 46054009 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | N-[6-(4-benzyl-1,4-diazepan-1-yl)-3-pyridinyl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)Nc1ccc(N2CCCN(Cc3ccccc3)CC2)nc1 |
| InChI | InChI=1S/C25H28N4O2/c30-25(20-31-23-10-5-2-6-11-23)27-22-12-13-24(26-18-22)29-15-7-14-28(16-17-29)19-21-8-3-1-4-9-21/h1-6,8-13,18H,7,14-17,19-20H2,(H,27,30) |
| InChIKey | UYRWAVOYPNEHRA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |