C27H32N4O — CID 92987360
(2R)-N-[6-(4-benzyl-1,4-diazepan-1-yl)-3-pyridinyl]-2-phenylbutanamide (PubChem CID 92987360) has the molecular formula C27H32N4O and a molecular weight of 428.58 g/mol. Its IUPAC name is (2R)-N-[6-(4-benzyl-1,4-diazepan-1-yl)-3-pyridinyl]-2-phenylbutanamide.
| Compound Name | (2R)-N-[6-(4-benzyl-1,4-diazepan-1-yl)-3-pyridinyl]-2-phenylbutanamide |
|---|---|
| PubChem CID | 92987360 |
| Molecular Formula | C27H32N4O |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | (2R)-N-[6-(4-benzyl-1,4-diazepan-1-yl)-3-pyridinyl]-2-phenylbutanamide |
| SMILES | CC[C@@H](C(=O)Nc1ccc(N2CCCN(Cc3ccccc3)CC2)nc1)c1ccccc1 |
| InChI | InChI=1S/C27H32N4O/c1-2-25(23-12-7-4-8-13-23)27(32)29-24-14-15-26(28-20-24)31-17-9-16-30(18-19-31)21-22-10-5-3-6-11-22/h3-8,10-15,20,25H,2,9,16-19,21H2,1H3,(H,29,32)/t25-/m1/s1 |
| InChIKey | KIMAICGGJIIGGE-RUZDIDTESA-N |
| XLogP | 4.93 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |