C22H30N4O2 — CID 42857905
N-[6-[4-(2-hydroxybutyl)-1,4-diazepan-1-yl]-3-pyridinyl]-2-phenylacetamide (PubChem CID 42857905) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is N-[6-[4-(2-hydroxybutyl)-1,4-diazepan-1-yl]-3-pyridinyl]-2-phenylacetamide.
| Compound Name | N-[6-[4-(2-hydroxybutyl)-1,4-diazepan-1-yl]-3-pyridinyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 42857905 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | N-[6-[4-(2-hydroxybutyl)-1,4-diazepan-1-yl]-3-pyridinyl]-2-phenylacetamide |
| SMILES | CCC(O)CN1CCCN(c2ccc(NC(=O)Cc3ccccc3)cn2)CC1 |
| InChI | InChI=1S/C22H30N4O2/c1-2-20(27)17-25-11-6-12-26(14-13-25)21-10-9-19(16-23-21)24-22(28)15-18-7-4-3-5-8-18/h3-5,7-10,16,20,27H,2,6,11-15,17H2,1H3,(H,24,28) |
| InChIKey | ANSFLUXUXMAYLY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |